Dihydrogen can be prepared on a commercial scale by different methods. In its preparation by the action of steam on hydrocarbons, a mixture of CO and H2 gas is formed. It is known as _____.

a.  Water gas

b.  Syngas

c.  Producer gas

d.  Industrial gas

Choose the correct option

1. (a, b)

2. (b, c)

3. (c, d)

4. (a, d)

Dihydrogen can be prepared on commercial scale by different methods. Reactions of steam on hydrocarbons or coke at high temperatures in the presence of catalyst yield hydrogen.
CnH2n+2+nH2O+2Ni1270KnCO2+(2n+1)H2
e.g.,CH4(g)+H2O(g)Ni1270KCO(g)+3H2(g)
The mixture of CO and H2 is called water gas. As this mixture of CO and H2 is used for the synthesis of methanol and a number of hydrocarbons, it is also called synthesis gas or 'syn gas'.